CAS 144849-07-0 is the registry number for 1-(5-methylisoxazol-3-yl)-3-((4-methylphenyl)sulfonyl)urea. Offered by: Biosynth. Available pack sizes: 250mg.
1-(5-methyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea (CAS 144849-07-0) is a chemical compound with the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. IUPAC name: 1-(5-methyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea. InChIKey: QPOIZWPVJOWFSB-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O4S |
|---|---|
| Molecular weight | 295.32 g/mol |
| IUPAC name | 1-(5-methyl-1,2-oxazol-3-yl)-3-(4-methylphenyl)sulfonylurea |
| InChIKey | QPOIZWPVJOWFSB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2=NOC(=C2)C |
Computed by PubChem (NCBI)