CAS 88614-99-7 is the registry number for N-Acetyl Isosulfamethoxazole. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
N-[4-[(3-methyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]acetamide (CAS 88614-99-7) is a chemical compound with the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. IUPAC name: N-[4-[(3-methyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]acetamide. InChIKey: UZSDDAKRNRQUHD-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O4S |
|---|---|
| Molecular weight | 295.32 g/mol |
| IUPAC name | N-[4-[(3-methyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]acetamide |
| InChIKey | UZSDDAKRNRQUHD-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)NS(=O)(=O)C2=CC=C(C=C2)NC(=O)C |
Computed by PubChem (NCBI)