CAS 144868-15-5 appears in our catalog under these names: (S)–2–diphenyphosphino,2'–hydroxyl–1,1'–binaphthyl, (S)-2'-(Diphenylphosphino)-[1,1'-binaphthalen]-2-ol, 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 25mg, 1g, 250mg.
1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-ol (CAS 144868-15-5) is a chemical compound with the molecular formula C32H23OP and a molecular weight of 454.5 g/mol. IUPAC name: 1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-ol. InChIKey: LWZAKMZAVUALLD-UHFFFAOYSA-N.
| Molecular formula | C32H23OP |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | 1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-ol |
| InChIKey | LWZAKMZAVUALLD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)O |
Computed by PubChem (NCBI)