CAS 193699-33-1 is the registry number for 8'-(Diphenylphosphino)-[1,1'-binaphthalen]-8-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-(8-diphenylphosphanylnaphthalen-1-yl)naphthalen-1-ol (CAS 193699-33-1) is a chemical compound with the molecular formula C32H23OP and a molecular weight of 454.5 g/mol. IUPAC name: 8-(8-diphenylphosphanylnaphthalen-1-yl)naphthalen-1-ol. InChIKey: PQFJWIICYVHBHB-UHFFFAOYSA-N.
| Molecular formula | C32H23OP |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | 8-(8-diphenylphosphanylnaphthalen-1-yl)naphthalen-1-ol |
| InChIKey | PQFJWIICYVHBHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC4=C3C(=CC=C4)C5=CC=CC6=C5C(=CC=C6)O |
Computed by PubChem (NCBI)