CAS 144878-40-0 appears in our catalog under these names: 4-Ethoxy-3-methoxycinnamic acid, 97%, (E)-3-(4-Ethoxy-3-methoxyphenyl)acrylic acid, (E)-3-(4-Ethoxy-3-methoxyphenyl)acrylic acid 95%, 4-Ethoxy-3-methoxycinnamic acid, 95%, 95%, (2E)-3-(4-ethoxy-3-methoxyphenyl)acrylic acid, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoic acid (CAS 144878-40-0) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoic acid. InChIKey: LJMXXNVTJTYKRH-FNORWQNLSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoic acid |
| InChIKey | LJMXXNVTJTYKRH-FNORWQNLSA-N |
| SMILES | CCOC1=C(C=C(C=C1)/C=C/C(=O)O)OC |
Computed by PubChem (NCBI)