Products 1448871-64-4
CAS 1448871-64-4 is the registry number for 2-(4-Methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetonitrile, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg, 250mg.
2-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile (CAS 1448871-64-4) is a chemical compound with the molecular formula C15H20BNO3 and a molecular weight of 273.14 g/mol. IUPAC name: 2-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile. InChIKey: WRDUMMNZTKZZNM-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO3 |
|---|---|
| Molecular weight | 273.14 g/mol |
| IUPAC name | 2-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile |
| InChIKey | WRDUMMNZTKZZNM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)CC#N)OC |
Computed by PubChem (NCBI)