CAS 1449018-41-0 is the registry number for 4,4'-(9,9-Diethyl-9H-fluorene-2,7-diyl)dipyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(9,9-diethyl-7-pyridin-4-ylfluoren-2-yl)pyridine (CAS 1449018-41-0) is a chemical compound with the molecular formula C27H24N2 and a molecular weight of 376.5 g/mol. IUPAC name: 4-(9,9-diethyl-7-pyridin-4-ylfluoren-2-yl)pyridine. InChIKey: LPNHKDNMNBPTJN-UHFFFAOYSA-N.
| Molecular formula | C27H24N2 |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | 4-(9,9-diethyl-7-pyridin-4-ylfluoren-2-yl)pyridine |
| InChIKey | LPNHKDNMNBPTJN-UHFFFAOYSA-N |
| SMILES | CCC1(C2=C(C=CC(=C2)C3=CC=NC=C3)C4=C1C=C(C=C4)C5=CC=NC=C5)CC |
Computed by PubChem (NCBI)