CAS 354987-86-3 appears in our catalog under these names: 9,9–Dimethyl–N2,N7–diphenyl–9H–fluorene–2,7–diamine, 9,9-Dimethyl-N2,N7-diphenyl-9H-fluorene-2,7-diamine, 95%, 95%, 9,9-Dimethyl-N2,N7-diphenyl-9H-fluorene-2,7-diamine, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
9,9-dimethyl-2-N,7-N-diphenylfluorene-2,7-diamine (CAS 354987-86-3) is a chemical compound with the molecular formula C27H24N2 and a molecular weight of 376.5 g/mol. IUPAC name: 9,9-dimethyl-2-N,7-N-diphenylfluorene-2,7-diamine. InChIKey: OZANGHRJXVCOBE-UHFFFAOYSA-N.
| Molecular formula | C27H24N2 |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | 9,9-dimethyl-2-N,7-N-diphenylfluorene-2,7-diamine |
| InChIKey | OZANGHRJXVCOBE-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)NC3=CC=CC=C3)C4=C1C=C(C=C4)NC5=CC=CC=C5)C |
Computed by PubChem (NCBI)