Products 1449117-26-3
CAS 1449117-26-3 is the registry number for 6-Cyclopropyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-diol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-cyclopropyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione (CAS 1449117-26-3) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. IUPAC name: 6-cyclopropyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione. InChIKey: VHUGZCUFGXQASE-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 6-cyclopropyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione |
| InChIKey | VHUGZCUFGXQASE-UHFFFAOYSA-N |
| SMILES | C1CC1N2CCC3=C(C2)C(=O)NC(=O)N3 |
Computed by PubChem (NCBI)