Products 1449133-06-5
CAS 1449133-06-5 is the registry number for ((4'-Chloro-[1,1'-biphenyl]-4-yl)sulfonyl)phenylalanine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-3-phenylpropanoic acid (CAS 1449133-06-5) is a chemical compound with the molecular formula C21H18ClNO4S and a molecular weight of 415.9 g/mol. IUPAC name: 2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-3-phenylpropanoic acid. InChIKey: TXFOUFDGVNFIGH-UHFFFAOYSA-N.
| Molecular formula | C21H18ClNO4S |
|---|---|
| Molecular weight | 415.9 g/mol |
| IUPAC name | 2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-3-phenylpropanoic acid |
| InChIKey | TXFOUFDGVNFIGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)NS(=O)(=O)C2=CC=C(C=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)