CAS 721416-48-4 appears in our catalog under these names: 4-([Benzyl-(4-chloro-benzenesulfonyl)-amino]-methyl)-benzoic acid, 95%, 4-((N-Benzyl4-chlorobenzenesulfonamido)methyl)benzoic acid, 4-((N-Benzyl4-chlorobenzenesulfonamido)methyl)benzoic acid, 95%. Offered by: Combi-blocks, Biosynth, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
4-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]benzoic acid (CAS 721416-48-4) is a chemical compound with the molecular formula C21H18ClNO4S and a molecular weight of 415.9 g/mol. IUPAC name: 4-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]benzoic acid. InChIKey: VOEXELGKQPYTIN-UHFFFAOYSA-N.
| Molecular formula | C21H18ClNO4S |
|---|---|
| Molecular weight | 415.9 g/mol |
| IUPAC name | 4-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]benzoic acid |
| InChIKey | VOEXELGKQPYTIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=C(C=C2)C(=O)O)S(=O)(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)