Products 1449301-71-6
CAS 1449301-71-6 is the registry number for 5-Bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 1449301-71-6) is a chemical compound with the molecular formula C11H16BBrN2O2 and a molecular weight of 298.97 g/mol. IUPAC name: 5-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: ZYDXJCGHPMGSOG-UHFFFAOYSA-N.
| Molecular formula | C11H16BBrN2O2 |
|---|---|
| Molecular weight | 298.97 g/mol |
| IUPAC name | 5-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | ZYDXJCGHPMGSOG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2N)Br |
Computed by PubChem (NCBI)