CAS 1449430-45-8 is the registry number for Afatinib Impurity 54. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-chloro-4-fluoroanilino)-6-nitroquinazolin-7-ol (CAS 1449430-45-8) is a chemical compound with the molecular formula C14H8ClFN4O3 and a molecular weight of 334.69 g/mol. IUPAC name: 4-(3-chloro-4-fluoroanilino)-6-nitroquinazolin-7-ol. InChIKey: ODEICIIOTUWISY-UHFFFAOYSA-N.
| Molecular formula | C14H8ClFN4O3 |
|---|---|
| Molecular weight | 334.69 g/mol |
| IUPAC name | 4-(3-chloro-4-fluoroanilino)-6-nitroquinazolin-7-ol |
| InChIKey | ODEICIIOTUWISY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC2=NC=NC3=CC(=C(C=C32)[N+](=O)[O-])O)Cl)F |
Computed by PubChem (NCBI)