CAS 2475094-95-0 appears in our catalog under these names: Afatinib Impurity 2, 4-((4-Chloro-3-fluorophenyl)amino)-6-nitroquinazolin-7-ol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
4-(4-chloro-3-fluoroanilino)-6-nitroquinazolin-7-ol (CAS 2475094-95-0) is a chemical compound with the molecular formula C14H8ClFN4O3 and a molecular weight of 334.69 g/mol. IUPAC name: 4-(4-chloro-3-fluoroanilino)-6-nitroquinazolin-7-ol. InChIKey: ZUMMGAHGJRRECH-UHFFFAOYSA-N.
| Molecular formula | C14H8ClFN4O3 |
|---|---|
| Molecular weight | 334.69 g/mol |
| IUPAC name | 4-(4-chloro-3-fluoroanilino)-6-nitroquinazolin-7-ol |
| InChIKey | ZUMMGAHGJRRECH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC2=NC=NC3=CC(=C(C=C32)[N+](=O)[O-])O)F)Cl |
Computed by PubChem (NCBI)