Products 1449599-13-6
CAS 1449599-13-6 is the registry number for 6-bromo-4-fluoro-2-methyl-1,3-benzoxazole, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
6-bromo-4-fluoro-2-methyl-1,3-benzoxazole (CAS 1449599-13-6) is a chemical compound with the molecular formula C8H5BrFNO and a molecular weight of 230.03 g/mol. IUPAC name: 6-bromo-4-fluoro-2-methyl-1,3-benzoxazole. InChIKey: YRIIBJDQDIQTAG-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO |
|---|---|
| Molecular weight | 230.03 g/mol |
| IUPAC name | 6-bromo-4-fluoro-2-methyl-1,3-benzoxazole |
| InChIKey | YRIIBJDQDIQTAG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(O1)C=C(C=C2F)Br |
Computed by PubChem (NCBI)