CAS 1449741-18-7 is the registry number for 2-((1R,2R)-2-Aminocyclopropyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1R,2R)-2-aminocyclopropyl]acetic acid (CAS 1449741-18-7) is a chemical compound with the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. IUPAC name: 2-[(1R,2R)-2-aminocyclopropyl]acetic acid. InChIKey: ZHRWZBGJTSPCGJ-QWWZWVQMSA-N.
| Molecular formula | C5H9NO2 |
|---|---|
| Molecular weight | 115.13 g/mol |
| IUPAC name | 2-[(1R,2R)-2-aminocyclopropyl]acetic acid |
| InChIKey | ZHRWZBGJTSPCGJ-QWWZWVQMSA-N |
| SMILES | C1[C@@H]([C@@H]1N)CC(=O)O |
Computed by PubChem (NCBI)