Products 84673-53-0

CAS 84673-53-0 is the registry number for rel-2-((1S,2S)-2-Aminocyclopropyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(1S,2S)-2-aminocyclopropyl]acetic acid (CAS 84673-53-0) is a chemical compound with the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. IUPAC name: 2-[(1S,2S)-2-aminocyclopropyl]acetic acid. InChIKey: ZHRWZBGJTSPCGJ-IMJSIDKUSA-N.

Identity
Molecular formulaC5H9NO2
Molecular weight115.13 g/mol
IUPAC name2-[(1S,2S)-2-aminocyclopropyl]acetic acid
InChIKeyZHRWZBGJTSPCGJ-IMJSIDKUSA-N
SMILESC1[C@H]([C@H]1N)CC(=O)O

Computed by PubChem (NCBI)