Products 144991-53-7
CAS 144991-53-7 appears in our catalog under these names: 2,6-Dimethyl-4-(trifluoromethyl)aniline, 2,6-Dimethyl-4-(trifluoromethyl)aniline, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,1g, 0,25g, 0,5g, 1g, 50mg, 100mg, 250mg.
2,6-dimethyl-4-(trifluoromethyl)aniline (CAS 144991-53-7) is a chemical compound with the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. IUPAC name: 2,6-dimethyl-4-(trifluoromethyl)aniline. InChIKey: AKHBCRYOUZZLGV-UHFFFAOYSA-N.
| Molecular formula | C9H10F3N |
|---|---|
| Molecular weight | 189.18 g/mol |
| IUPAC name | 2,6-dimethyl-4-(trifluoromethyl)aniline |
| InChIKey | AKHBCRYOUZZLGV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C)C(F)(F)F |
Computed by PubChem (NCBI)