CAS 14501-92-9 is the registry number for 3-(3-Chloro-2-methylphenyl)-1,1-dimethylthiourea, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-chloro-2-methylphenyl)-1,1-dimethylthiourea (CAS 14501-92-9) is a chemical compound with the molecular formula C10H13ClN2S and a molecular weight of 228.74 g/mol. IUPAC name: 3-(3-chloro-2-methylphenyl)-1,1-dimethylthiourea. InChIKey: VDRHQLCPRIPFBZ-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2S |
|---|---|
| Molecular weight | 228.74 g/mol |
| IUPAC name | 3-(3-chloro-2-methylphenyl)-1,1-dimethylthiourea |
| InChIKey | VDRHQLCPRIPFBZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Cl)NC(=S)N(C)C |
Computed by PubChem (NCBI)