CAS 1879534-47-0 is the registry number for 3-Chloro-N-(2,2-dimethylthietan-3-yl)pyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-N-(2,2-dimethylthietan-3-yl)pyridin-2-amine (CAS 1879534-47-0) is a chemical compound with the molecular formula C10H13ClN2S and a molecular weight of 228.74 g/mol. IUPAC name: 3-chloro-N-(2,2-dimethylthietan-3-yl)pyridin-2-amine. InChIKey: JFWIZUDNTAVFED-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2S |
|---|---|
| Molecular weight | 228.74 g/mol |
| IUPAC name | 3-chloro-N-(2,2-dimethylthietan-3-yl)pyridin-2-amine |
| InChIKey | JFWIZUDNTAVFED-UHFFFAOYSA-N |
| SMILES | CC1(C(CS1)NC2=C(C=CC=N2)Cl)C |
Computed by PubChem (NCBI)