CAS 1450828-98-4 appears in our catalog under these names: (1R,2S,5R)-(-)-Menthol-d4, >95% (GC), (-)-Menthol-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 2.5 mg, 5 mg, 1 mg.
(1R,3R,6S)-1,2,2,6-tetradeuterio-3-methyl-6-propan-2-ylcyclohexan-1-ol (CAS 1450828-98-4) is a chemical compound with the molecular formula C10H20O and a molecular weight of 160.29 g/mol. IUPAC name: (1R,3R,6S)-1,2,2,6-tetradeuterio-3-methyl-6-propan-2-ylcyclohexan-1-ol. InChIKey: NOOLISFMXDJSKH-JVBCQMCMSA-N.
| Molecular formula | C10H20O |
|---|---|
| Molecular weight | 160.29 g/mol |
| IUPAC name | (1R,3R,6S)-1,2,2,6-tetradeuterio-3-methyl-6-propan-2-ylcyclohexan-1-ol |
| InChIKey | NOOLISFMXDJSKH-JVBCQMCMSA-N |
| SMILES | [2H][C@]1(CC[C@H](C([C@@]1([2H])O)([2H])[2H])C)C(C)C |
Computed by PubChem (NCBI)