CAS 1450990-33-6 is the registry number for Vismodegib-d4. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 10 mg, 5 mg, 1 mg.
2-chloro-N-[4-chloro-3-(3,4,5,6-tetradeuterio-2-pyridinyl)phenyl]-4-methylsulfonylbenzamide (CAS 1450990-33-6) is a chemical compound with the molecular formula C19H14Cl2N2O3S and a molecular weight of 425.3 g/mol. IUPAC name: 2-chloro-N-[4-chloro-3-(3,4,5,6-tetradeuterio-2-pyridinyl)phenyl]-4-methylsulfonylbenzamide. InChIKey: BPQMGSKTAYIVFO-CKSJCSQYSA-N.
| Molecular formula | C19H14Cl2N2O3S |
|---|---|
| Molecular weight | 425.3 g/mol |
| IUPAC name | 2-chloro-N-[4-chloro-3-(3,4,5,6-tetradeuterio-2-pyridinyl)phenyl]-4-methylsulfonylbenzamide |
| InChIKey | BPQMGSKTAYIVFO-CKSJCSQYSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])C2=C(C=CC(=C2)NC(=O)C3=C(C=C(C=C3)S(=O)(=O)C)Cl)Cl)[2H])[2H] |
Computed by PubChem (NCBI)