CAS 1451208-90-4 is the registry number for 4-Methoxy-6,7-dimethylbenzo[d]thiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methoxy-6,7-dimethyl-1,3-benzothiazol-2-amine (CAS 1451208-90-4) is a chemical compound with the molecular formula C10H12N2OS and a molecular weight of 208.28 g/mol. IUPAC name: 4-methoxy-6,7-dimethyl-1,3-benzothiazol-2-amine. InChIKey: YAFOWEDUFOUONX-UHFFFAOYSA-N.
| Molecular formula | C10H12N2OS |
|---|---|
| Molecular weight | 208.28 g/mol |
| IUPAC name | 4-methoxy-6,7-dimethyl-1,3-benzothiazol-2-amine |
| InChIKey | YAFOWEDUFOUONX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1C)SC(=N2)N)OC |
Computed by PubChem (NCBI)