CAS 2561433-22-3 is the registry number for (S)-3-Amino-5-methyl-2,3-dihydrobenzo[b][1,4]oxazepine-4(5H)-thione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepine-4-thione (CAS 2561433-22-3) is a chemical compound with the molecular formula C10H12N2OS and a molecular weight of 208.28 g/mol. IUPAC name: (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepine-4-thione. InChIKey: WENDXLNXBQDIKC-ZETCQYMHSA-N.
| Molecular formula | C10H12N2OS |
|---|---|
| Molecular weight | 208.28 g/mol |
| IUPAC name | (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepine-4-thione |
| InChIKey | WENDXLNXBQDIKC-ZETCQYMHSA-N |
| SMILES | CN1C2=CC=CC=C2OC[C@@H](C1=S)N |
Computed by PubChem (NCBI)