Products 145126-87-0

CAS 145126-87-0 is the registry number for Olopatadine Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(methylamino)propyl-triphenylphosphanium bromide (CAS 145126-87-0) is a chemical compound with the molecular formula C22H25BrNP and a molecular weight of 414.3 g/mol. IUPAC name: 3-(methylamino)propyl-triphenylphosphanium bromide. InChIKey: COPZBGVEAWELFU-UHFFFAOYSA-M.

Identity
Molecular formulaC22H25BrNP
Molecular weight414.3 g/mol
IUPAC name3-(methylamino)propyl-triphenylphosphanium bromide
InChIKeyCOPZBGVEAWELFU-UHFFFAOYSA-M
SMILESCNCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]

Computed by PubChem (NCBI)