CAS 145126-87-0 is the registry number for Olopatadine Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
3-(methylamino)propyl-triphenylphosphanium bromide (CAS 145126-87-0) is a chemical compound with the molecular formula C22H25BrNP and a molecular weight of 414.3 g/mol. IUPAC name: 3-(methylamino)propyl-triphenylphosphanium bromide. InChIKey: COPZBGVEAWELFU-UHFFFAOYSA-M.
| Molecular formula | C22H25BrNP |
|---|---|
| Molecular weight | 414.3 g/mol |
| IUPAC name | 3-(methylamino)propyl-triphenylphosphanium bromide |
| InChIKey | COPZBGVEAWELFU-UHFFFAOYSA-M |
| SMILES | CNCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)