CAS 21331-80-6 appears in our catalog under these names: (2-Dimethylaminoethyl)triphenylphosphonium bromide, 98%, (2-(Dimethylamino)ethyl)triphenylphosphonium bromide, 98+%, 2–Dimethylaminoethyltriphenylphosphonium Bromide. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 25g, 1g, 5g.
2-(dimethylamino)ethyl-triphenylphosphanium bromide (CAS 21331-80-6) is a chemical compound with the molecular formula C22H25BrNP and a molecular weight of 414.3 g/mol. IUPAC name: 2-(dimethylamino)ethyl-triphenylphosphanium bromide. InChIKey: YIIHEMGEQQWSMA-UHFFFAOYSA-M.
| Molecular formula | C22H25BrNP |
|---|---|
| Molecular weight | 414.3 g/mol |
| IUPAC name | 2-(dimethylamino)ethyl-triphenylphosphanium bromide |
| InChIKey | YIIHEMGEQQWSMA-UHFFFAOYSA-M |
| SMILES | CN(C)CC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)