CAS 1451390-78-5 appears in our catalog under these names: 4-Acetyl-2,3-difluorophenylboronic acid, 97%, (4-Acetyl-2,3-difluorophenyl)boronic acid, 98+%, 4-Acetyl-2,3-difluorophenylboronic acid, ≥95%, ≥95%, 4-Acetyl-2,3-difluorophenylboronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 100g, 5g.
(4-acetyl-2,3-difluorophenyl)boronic acid (CAS 1451390-78-5) is a chemical compound with the molecular formula C8H7BF2O3 and a molecular weight of 199.95 g/mol. IUPAC name: (4-acetyl-2,3-difluorophenyl)boronic acid. InChIKey: HTKOABRFNDIGPM-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O3 |
|---|---|
| Molecular weight | 199.95 g/mol |
| IUPAC name | (4-acetyl-2,3-difluorophenyl)boronic acid |
| InChIKey | HTKOABRFNDIGPM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C(=O)C)F)F)(O)O |
Computed by PubChem (NCBI)