CAS 1451390-81-0 appears in our catalog under these names: 3-Acetyl-2,6-difluorophenylboronic acid, 95%, (3-Acetyl-2,6-difluorophenyl)boronic acid, 98+%, 3-Acetyl-2,6-difluorophenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
(3-acetyl-2,6-difluorophenyl)boronic acid (CAS 1451390-81-0) is a chemical compound with the molecular formula C8H7BF2O3 and a molecular weight of 199.95 g/mol. IUPAC name: (3-acetyl-2,6-difluorophenyl)boronic acid. InChIKey: MOLKUWDTTSLAMM-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O3 |
|---|---|
| Molecular weight | 199.95 g/mol |
| IUPAC name | (3-acetyl-2,6-difluorophenyl)boronic acid |
| InChIKey | MOLKUWDTTSLAMM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)C(=O)C)F)(O)O |
Computed by PubChem (NCBI)