CAS 2225155-40-6 is the registry number for 3–(Piperidin–4–yl)–4–trifluoromethylphenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
[3-piperidin-4-yl-4-(trifluoromethyl)phenyl]boronic acid (CAS 2225155-40-6) is a chemical compound with the molecular formula C12H15BF3NO2 and a molecular weight of 273.06 g/mol. IUPAC name: [3-piperidin-4-yl-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: YLQFZWUTQXOXGU-UHFFFAOYSA-N.
| Molecular formula | C12H15BF3NO2 |
|---|---|
| Molecular weight | 273.06 g/mol |
| IUPAC name | [3-piperidin-4-yl-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | YLQFZWUTQXOXGU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(F)(F)F)C2CCNCC2)(O)O |
Computed by PubChem (NCBI)