CAS 1451392-33-8 appears in our catalog under these names: 4-(N,O-Dimethylhydroxylaminocarbonyl)-2-chlorophenylboronic acid, 95%, (2-Chloro-4-(methoxy(methyl)carbamoyl)phenyl)boronic acid, ≥95%, ≥95%, 4-(N,O-Dimethylhydroxylaminocarbonyl)-2-chlorophenylboronic acid, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
[2-chloro-4-[methoxy(methyl)carbamoyl]phenyl]boronic acid (CAS 1451392-33-8) is a chemical compound with the molecular formula C9H11BClNO4 and a molecular weight of 243.45 g/mol. IUPAC name: [2-chloro-4-[methoxy(methyl)carbamoyl]phenyl]boronic acid. InChIKey: MRCQFYXCASZGBY-UHFFFAOYSA-N.
| Molecular formula | C9H11BClNO4 |
|---|---|
| Molecular weight | 243.45 g/mol |
| IUPAC name | [2-chloro-4-[methoxy(methyl)carbamoyl]phenyl]boronic acid |
| InChIKey | MRCQFYXCASZGBY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)N(C)OC)Cl)(O)O |
Computed by PubChem (NCBI)