CAS 3075275-82-7 is the registry number for (R)-DS86760016, 98.68%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 50 mg, 100 mg, 5 mg.
[(3R)-1-hydroxy-3H-[1,3]dioxolo[4,5-g][2,1]benzoxaborol-3-yl]methanamine;hydrochloride (CAS 3075275-82-7) is a chemical compound with the molecular formula C9H11BClNO4 and a molecular weight of 243.45 g/mol. IUPAC name: [(3R)-1-hydroxy-3H-[1,3]dioxolo[4,5-g][2,1]benzoxaborol-3-yl]methanamine;hydrochloride. InChIKey: FYHCZFHPLJMBAX-FJXQXJEOSA-N.
| Molecular formula | C9H11BClNO4 |
|---|---|
| Molecular weight | 243.45 g/mol |
| IUPAC name | [(3R)-1-hydroxy-3H-[1,3]dioxolo[4,5-g][2,1]benzoxaborol-3-yl]methanamine;hydrochloride |
| InChIKey | FYHCZFHPLJMBAX-FJXQXJEOSA-N |
| SMILES | B1(C2=C(C=CC3=C2OCO3)[C@@H](O1)CN)O.Cl |
Computed by PubChem (NCBI)