CAS 1451392-97-4 appears in our catalog under these names: 4-Carboxy-2,6-dichlorophenylboronic Acid, 4-Carboxy-2,6-dichlorophenylboronic acid, 95%, 4-Borono-3,5-dichlorobenzoic acid, 95+%. Offered by: TRC, Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 500mg, 1g, 250mg, 10g, 5g, 25g, 100mg.
4-borono-3,5-dichlorobenzoic acid (CAS 1451392-97-4) is a chemical compound with the molecular formula C7H5BCl2O4 and a molecular weight of 234.83 g/mol. IUPAC name: 4-borono-3,5-dichlorobenzoic acid. InChIKey: AAWMXCHCDYCQAL-UHFFFAOYSA-N.
| Molecular formula | C7H5BCl2O4 |
|---|---|
| Molecular weight | 234.83 g/mol |
| IUPAC name | 4-borono-3,5-dichlorobenzoic acid |
| InChIKey | AAWMXCHCDYCQAL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Cl)C(=O)O)Cl)(O)O |
Computed by PubChem (NCBI)