CAS 2351934-06-8 appears in our catalog under these names: 2,3-Dichloro-4-(dihydroxyboranyl)benzoic acid, 95%, 4-Borono-2,3-dichlorobenzoic acid, 98%, 2,3-Dichloro-4-(dihydroxyboranyl)benzoic acid, ≥95%, ≥95%, 2,3-Dichloro-4-(dihydroxyboranyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
4-borono-2,3-dichlorobenzoic acid (CAS 2351934-06-8) is a chemical compound with the molecular formula C7H5BCl2O4 and a molecular weight of 234.83 g/mol. IUPAC name: 4-borono-2,3-dichlorobenzoic acid. InChIKey: PAUFTOFUMFTBBY-UHFFFAOYSA-N.
| Molecular formula | C7H5BCl2O4 |
|---|---|
| Molecular weight | 234.83 g/mol |
| IUPAC name | 4-borono-2,3-dichlorobenzoic acid |
| InChIKey | PAUFTOFUMFTBBY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C(=O)O)Cl)Cl)(O)O |
Computed by PubChem (NCBI)