CAS 1451393-24-0 appears in our catalog under these names: 3-Formyl-5-(trifluoromethyl)phenylboronic acid, 98%, (3-Formyl-5-(trifluoromethyl)phenyl)boronic acid, 98%, 3-Formyl-5-(trifluoromethyl)phenylboronic acid, ≥95%, ≥95%, (3-Formyl-5-(trifluoromethyl)phenyl)boronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
[3-formyl-5-(trifluoromethyl)phenyl]boronic acid (CAS 1451393-24-0) is a chemical compound with the molecular formula C8H6BF3O3 and a molecular weight of 217.94 g/mol. IUPAC name: [3-formyl-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: PUGXLUVQWNOCAW-UHFFFAOYSA-N.
| Molecular formula | C8H6BF3O3 |
|---|---|
| Molecular weight | 217.94 g/mol |
| IUPAC name | [3-formyl-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | PUGXLUVQWNOCAW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(F)(F)F)C=O)(O)O |
Computed by PubChem (NCBI)