Products 2377606-70-5
CAS 2377606-70-5 is the registry number for 5-Formyl-2-(trifluoromethyl)phenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
[5-formyl-2-(trifluoromethyl)phenyl]boronic acid (CAS 2377606-70-5) is a chemical compound with the molecular formula C8H6BF3O3 and a molecular weight of 217.94 g/mol. IUPAC name: [5-formyl-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: QFOXOZRQTWLEPJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BF3O3 |
|---|---|
| Molecular weight | 217.94 g/mol |
| IUPAC name | [5-formyl-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | QFOXOZRQTWLEPJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C=O)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)