Products 1451750-73-4
CAS 1451750-73-4 appears in our catalog under these names: TETi76, TETi76, 97%, 97%, TETi76, 97.49%, TETi76 diethyl ester >= 95 % GC. Offered by: GLPBio, Chemat, MedChemExpress, Sigma-Aldrich. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100mg, 250mg, 1g, 25 mg.
Diethyl 2-hydroxy-4-methylidenepentanedioate (CAS 1451750-73-4) is a chemical compound with the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. IUPAC name: diethyl 2-hydroxy-4-methylidenepentanedioate. InChIKey: KEGNSROWYBDVRX-UHFFFAOYSA-N.
| Molecular formula | C10H16O5 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | diethyl 2-hydroxy-4-methylidenepentanedioate |
| InChIKey | KEGNSROWYBDVRX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC(=C)C(=O)OCC)O |
Computed by PubChem (NCBI)