Products 19515-61-8

CAS 19515-61-8 is the registry number for Diethyl 2-(3-oxopropyl)malonate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl 2-(3-oxopropyl)propanedioate (CAS 19515-61-8) is a chemical compound with the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. IUPAC name: diethyl 2-(3-oxopropyl)propanedioate. InChIKey: FGQNJWQEVPVFIN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O5
Molecular weight216.23 g/mol
IUPAC namediethyl 2-(3-oxopropyl)propanedioate
InChIKeyFGQNJWQEVPVFIN-UHFFFAOYSA-N
SMILESCCOC(=O)C(CCC=O)C(=O)OCC

Computed by PubChem (NCBI)