Products 1451998-30-3
CAS 1451998-30-3 is the registry number for tert-Butyl 3-(3-bromophenyl)-3-hydroxyazetidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(3-bromophenyl)-3-hydroxyazetidine-1-carboxylate (CAS 1451998-30-3) is a chemical compound with the molecular formula C14H18BrNO3 and a molecular weight of 328.20 g/mol. IUPAC name: tert-butyl 3-(3-bromophenyl)-3-hydroxyazetidine-1-carboxylate. InChIKey: UTCMJEJVDYIECE-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO3 |
|---|---|
| Molecular weight | 328.20 g/mol |
| IUPAC name | tert-butyl 3-(3-bromophenyl)-3-hydroxyazetidine-1-carboxylate |
| InChIKey | UTCMJEJVDYIECE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C2=CC(=CC=C2)Br)O |
Computed by PubChem (NCBI)