Products 145209-44-5
CAS 145209-44-5 is the registry number for N1-Norposiphen. Offered by: TRC. Available pack sizes: 50mg.
[(3aR,8bS)-4,8b-dimethyl-1,2,3,3a-tetrahydropyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate (CAS 145209-44-5) is a chemical compound with the molecular formula C19H21N3O2 and a molecular weight of 323.4 g/mol. IUPAC name: [(3aR,8bS)-4,8b-dimethyl-1,2,3,3a-tetrahydropyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate. InChIKey: ITTCFQIHBIBVEN-MJGOQNOKSA-N.
| Molecular formula | C19H21N3O2 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | [(3aR,8bS)-4,8b-dimethyl-1,2,3,3a-tetrahydropyrrolo[2,3-b]indol-7-yl] N-phenylcarbamate |
| InChIKey | ITTCFQIHBIBVEN-MJGOQNOKSA-N |
| SMILES | C[C@@]12CCN[C@@H]1N(C3=C2C=C(C=C3)OC(=O)NC4=CC=CC=C4)C |
Computed by PubChem (NCBI)