Products 264285-90-7
CAS 264285-90-7 is the registry number for 5-Isopropyl-3(4-(4-aminobenzyl)phenyl)hydantoin, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
3-[4-[(4-aminophenyl)methyl]phenyl]-5-propan-2-ylimidazolidine-2,4-dione (CAS 264285-90-7) is a chemical compound with the molecular formula C19H21N3O2 and a molecular weight of 323.4 g/mol. IUPAC name: 3-[4-[(4-aminophenyl)methyl]phenyl]-5-propan-2-ylimidazolidine-2,4-dione. InChIKey: AALBZULTUPBASL-UHFFFAOYSA-N.
| Molecular formula | C19H21N3O2 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 3-[4-[(4-aminophenyl)methyl]phenyl]-5-propan-2-ylimidazolidine-2,4-dione |
| InChIKey | AALBZULTUPBASL-UHFFFAOYSA-N |
| SMILES | CC(C)C1C(=O)N(C(=O)N1)C2=CC=C(C=C2)CC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)