Products 1452487-93-2

CAS 1452487-93-2 is the registry number for Diarylcomosol III. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.

Structural formula: {0} (CAS {1})

(3R,5S)-1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxyphenyl)heptane-3,5-diol (CAS 1452487-93-2) is a chemical compound with the molecular formula C21H28O6 and a molecular weight of 376.4 g/mol. IUPAC name: (3R,5S)-1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxyphenyl)heptane-3,5-diol. InChIKey: OJGXSPXNGOVDNO-ZWKOTPCHSA-N.

Identity
Molecular formulaC21H28O6
Molecular weight376.4 g/mol
IUPAC name(3R,5S)-1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxyphenyl)heptane-3,5-diol
InChIKeyOJGXSPXNGOVDNO-ZWKOTPCHSA-N
SMILESCOC1=CC(=CC(=C1O)OC)CC[C@H](C[C@H](CCC2=CC=C(C=C2)O)O)O

Computed by PubChem (NCBI)