Products 145283-66-5

CAS 145283-66-5 is the registry number for 2-Oxo-1,3-thiazolidine-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-oxo-1,3-thiazolidine-5-carboxylic acid (CAS 145283-66-5) is a chemical compound with the molecular formula C4H5NO3S and a molecular weight of 147.15 g/mol. IUPAC name: 2-oxo-1,3-thiazolidine-5-carboxylic acid. InChIKey: XAUYBXHQDHHHGE-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5NO3S
Molecular weight147.15 g/mol
IUPAC name2-oxo-1,3-thiazolidine-5-carboxylic acid
InChIKeyXAUYBXHQDHHHGE-UHFFFAOYSA-N
SMILESC1C(SC(=O)N1)C(=O)O

Computed by PubChem (NCBI)