Products 749255-18-3

CAS 749255-18-3 is the registry number for 1H-Pyrrole-3-sulfonic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

1H-pyrrole-3-sulfonic acid (CAS 749255-18-3) is a chemical compound with the molecular formula C4H5NO3S and a molecular weight of 147.15 g/mol. IUPAC name: 1H-pyrrole-3-sulfonic acid. InChIKey: GSRNKRUJQAFELZ-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5NO3S
Molecular weight147.15 g/mol
IUPAC name1H-pyrrole-3-sulfonic acid
InChIKeyGSRNKRUJQAFELZ-UHFFFAOYSA-N
SMILESC1=CNC=C1S(=O)(=O)O

Computed by PubChem (NCBI)