Products 1453100-61-2
CAS 1453100-61-2 appears in our catalog under these names: Decoquinate D5, Decoquinate-d5 (7-Ethoxy-d5), D5-Decoquinate, ISO 17034 RM, D5-Decoquinate, 100 µg/ml in Acetonitrile, ISO 17034 CRM, Decoquinate-D5. Offered by: Dr. Ehrenstorfer, TRC, HPC Standards, Sigma-Aldrich. Available pack sizes: 10mg, 100mg, 1ml.
Ethyl 6-decoxy-4-oxo-7-(1,1,2,2,2-pentadeuterioethoxy)-1H-quinoline-3-carboxylate (CAS 1453100-61-2) is a chemical compound with the molecular formula C24H35NO5 and a molecular weight of 422.6 g/mol. IUPAC name: ethyl 6-decoxy-4-oxo-7-(1,1,2,2,2-pentadeuterioethoxy)-1H-quinoline-3-carboxylate. InChIKey: JHAYEQICABJSTP-ZTIZGVCASA-N.
| Molecular formula | C24H35NO5 |
|---|---|
| Molecular weight | 422.6 g/mol |
| IUPAC name | ethyl 6-decoxy-4-oxo-7-(1,1,2,2,2-pentadeuterioethoxy)-1H-quinoline-3-carboxylate |
| InChIKey | JHAYEQICABJSTP-ZTIZGVCASA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=C(C=C2C(=C1)NC=C(C2=O)C(=O)OCC)OCCCCCCCCCC |
Computed by PubChem (NCBI)