Products 951319-59-8
CAS 951319-59-8 appears in our catalog under these names: 16–phenoxy Prostaglandin F2α ethyl amide, 16-Phenoxy prostaglandin F2α ethyl amide. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 10 mg, 1 mg.
(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]cyclopentyl]-N-ethylhept-5-enamide (CAS 951319-59-8) is a chemical compound with the molecular formula C24H35NO5 and a molecular weight of 417.5 g/mol. IUPAC name: (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]cyclopentyl]-N-ethylhept-5-enamide. InChIKey: QDQJVWZWVBSDQO-YJDFRJIGSA-N.
| Molecular formula | C24H35NO5 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]cyclopentyl]-N-ethylhept-5-enamide |
| InChIKey | QDQJVWZWVBSDQO-YJDFRJIGSA-N |
| SMILES | CCNC(=O)CCC/C=C\C[C@H]1[C@H](C[C@H]([C@@H]1/C=C/[C@H](COC2=CC=CC=C2)O)O)O |
Computed by PubChem (NCBI)