Products 1453188-68-5
CAS 1453188-68-5 is the registry number for 4-Methyl-2,6-bis(pyridin-4-ylethynyl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-2,6-bis(2-pyridin-4-ylethynyl)aniline (CAS 1453188-68-5) is a chemical compound with the molecular formula C21H15N3 and a molecular weight of 309.4 g/mol. IUPAC name: 4-methyl-2,6-bis(2-pyridin-4-ylethynyl)aniline. InChIKey: BHILGUPRELHDGB-UHFFFAOYSA-N.
| Molecular formula | C21H15N3 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 4-methyl-2,6-bis(2-pyridin-4-ylethynyl)aniline |
| InChIKey | BHILGUPRELHDGB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C#CC2=CC=NC=C2)N)C#CC3=CC=NC=C3 |
Computed by PubChem (NCBI)