CAS 58345-97-4 appears in our catalog under these names: 4'-Phenyl-2,2':6',2''-terpyridine, 97%, 97%, 4'–Phenyl–2,2':6',2''–terpyridine, 4'-Phenyl-2,2':6',2''-terpyridine 98%, 4'-Phenyl-2,2':6',2''-terpyridine, 98%, 4'-Phenyl-2,2':6',2''-terpyridine, >98.0%(T). Offered by: Chemat, GLPBio, Ambeed, Fluorochem, TCI. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g, 100g.
4-phenyl-2,6-dipyridin-2-ylpyridine (CAS 58345-97-4) is a chemical compound with the molecular formula C21H15N3 and a molecular weight of 309.4 g/mol. IUPAC name: 4-phenyl-2,6-dipyridin-2-ylpyridine. InChIKey: RTECKDZOLWRAGK-UHFFFAOYSA-N.
| Molecular formula | C21H15N3 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 4-phenyl-2,6-dipyridin-2-ylpyridine |
| InChIKey | RTECKDZOLWRAGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=C2)C3=CC=CC=N3)C4=CC=CC=N4 |
Computed by PubChem (NCBI)