Products 1453272-47-3

CAS 1453272-47-3 is the registry number for Ethyl 4-(piperidin-4-yl)benzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 4-piperidin-4-ylbenzoate;hydrochloride (CAS 1453272-47-3) is a chemical compound with the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. IUPAC name: ethyl 4-piperidin-4-ylbenzoate;hydrochloride. InChIKey: OELUZMWSKRZQTB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20ClNO2
Molecular weight269.77 g/mol
IUPAC nameethyl 4-piperidin-4-ylbenzoate;hydrochloride
InChIKeyOELUZMWSKRZQTB-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=C(C=C1)C2CCNCC2.Cl

Computed by PubChem (NCBI)