CAS 154606-14-1 is the registry number for 5-(2-Methylpropoxy)-2-nitrobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(2-methylpropoxy)-2-nitrobenzoic acid (CAS 154606-14-1) is a chemical compound with the molecular formula C11H13NO5 and a molecular weight of 239.22 g/mol. IUPAC name: 5-(2-methylpropoxy)-2-nitrobenzoic acid. InChIKey: WLMYSSSLRUWRDV-UHFFFAOYSA-N.
| Molecular formula | C11H13NO5 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | 5-(2-methylpropoxy)-2-nitrobenzoic acid |
| InChIKey | WLMYSSSLRUWRDV-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=CC(=C(C=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)