Products 154606-14-1

CAS 154606-14-1 is the registry number for 5-(2-Methylpropoxy)-2-nitrobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-(2-methylpropoxy)-2-nitrobenzoic acid (CAS 154606-14-1) is a chemical compound with the molecular formula C11H13NO5 and a molecular weight of 239.22 g/mol. IUPAC name: 5-(2-methylpropoxy)-2-nitrobenzoic acid. InChIKey: WLMYSSSLRUWRDV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO5
Molecular weight239.22 g/mol
IUPAC name5-(2-methylpropoxy)-2-nitrobenzoic acid
InChIKeyWLMYSSSLRUWRDV-UHFFFAOYSA-N
SMILESCC(C)COC1=CC(=C(C=C1)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)