CAS 145395-64-8 is the registry number for 2-(Ethyl-d5)hexanoic Acid. Offered by: TRC. Available pack sizes: 100mg.
2-(1,1,2,2,2-pentadeuterioethyl)hexanoic acid (CAS 145395-64-8) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 149.24 g/mol. IUPAC name: 2-(1,1,2,2,2-pentadeuterioethyl)hexanoic acid. InChIKey: OBETXYAYXDNJHR-PVGOWFQYSA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 149.24 g/mol |
| IUPAC name | 2-(1,1,2,2,2-pentadeuterioethyl)hexanoic acid |
| InChIKey | OBETXYAYXDNJHR-PVGOWFQYSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(CCCC)C(=O)O |
Computed by PubChem (NCBI)